N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide
Modify Date: 2026-07-18 19:27:51
N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide structure
|
Common Name | N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide | ||
|---|---|---|---|---|
| CAS Number | 1351663-97-2 | Molecular Weight | 255.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H17NO2 |
|---|---|
| Molecular Weight | 255.31 |
| InChIKey | RKVWNTKRNPAVKR-CMDGGOBGSA-N |
| SMILES | Cc1cc(CNC(=O)C=Cc2ccccc2)c(C)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1351663-97-2? |
| A: Chinese name of 1351663-97-2 is 1351663-97-2. |
| Q: What is the InChIKey of N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide? |
| A: InChIKey of N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide is RKVWNTKRNPAVKR-CMDGGOBGSA-N. |
| Q: What is the molecular formula of N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide? |
| A: Molecular formula of N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide is C16H17NO2. |
| Q: What is the molecular weight of N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide? |
| A: Molecular weight of N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide is 255.31. |
| Q: What is the SMILES notation of N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide? |
| A: SMILES notation of N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide is Cc1cc(CNC(=O)C=Cc2ccccc2)c(C)o1. |
| Q: What is the CAS number of N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide? |
| A: CAS number of N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide is 1351663-97-2. |
| Q: What is the English name of N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide? |
| A: The English name of N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide is N-((2,5-dimethylfuran-3-yl)methyl)cinnamamide. |