(E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane
Modify Date: 2026-07-18 16:24:41
![(E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane Structure](https://www.chemsrc.com/extcaspic/455/1351663-77-8.png)
(E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane structure
|
Common Name | (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane | ||
|---|---|---|---|---|
| CAS Number | 1351663-77-8 | Molecular Weight | 323.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H21NO4S |
|---|---|
| Molecular Weight | 323.4 |
| InChIKey | VJEWAOWDRRWNAS-VGOFMYFVSA-N |
| SMILES | O=S(=O)(C=Cc1ccccc1)N1CCC2(CC1)OCCCO2 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane? |
| A: SMILES notation of (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane is O=S(=O)(C=Cc1ccccc1)N1CCC2(CC1)OCCCO2. |
| Q: What is the molecular weight of (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane? |
| A: Molecular weight of (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane is 323.4. |
| Q: What is the Chinese name of 1351663-77-8? |
| A: Chinese name of 1351663-77-8 is 1351663-77-8. |
| Q: What is the CAS number of (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane? |
| A: CAS number of (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane is 1351663-77-8. |
| Q: What is the molecular formula of (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane? |
| A: Molecular formula of (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane is C16H21NO4S. |
| Q: What is the English name of (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane? |
| A: The English name of (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane is (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane. |
| Q: What is the InChIKey of (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane? |
| A: InChIKey of (E)-9-(styrylsulfonyl)-1,5-dioxa-9-azaspiro[5.5]undecane is VJEWAOWDRRWNAS-VGOFMYFVSA-N. |