6-methyl-2-phenyl-4(1h)pyrimidinone structure
|
Common Name | 6-methyl-2-phenyl-4(1h)pyrimidinone | ||
|---|---|---|---|---|
| CAS Number | 13514-79-9 | Molecular Weight | 186.21000 | |
| Density | 1.17g/cm3 | Boiling Point | 312.3ºC at 760mmHg | |
| Molecular Formula | C11H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.7ºC | |
| Name | 6-methyl-2-phenyl-1H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 312.3ºC at 760mmHg |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21000 |
| Flash Point | 142.7ºC |
| Exact Mass | 186.07900 |
| PSA | 46.01000 |
| LogP | 2.15760 |
| Vapour Pressure | 0.000534mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | BQXCSFIZYMLIAU-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)[nH]c(-c2ccccc2)n1 |
| HS Code | 2933599090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-methyl-2-phenyl-4-pyrimidinol |
| 6-Methyl-2-phenyl-4(1H)pyrimidinone |
| 2-phenyl-6-methyl-4(3H)-pyrimidone |
| 6-methyl-2-phenylpyrimidin-4(3H)-one |
| 6-methyl-2-phenylpyrimidin-4-one |
| 6-methyl-2-phenyl-3H-pyrimidin-4-one |
| 6-Methyl-2-phenylpyrimidin-4(1H)-one |
| 6-Methyl-2-phenylpyrimidin-4-ol |
| 6-methyl-2-phenyl-4(3H)-pyrimidone |
| 6-methyl-2-phenyl-4-pyrimidone |