1,3-DIBROMO-2,4,6-TRINITROBENZENE structure
|
Common Name | 1,3-DIBROMO-2,4,6-TRINITROBENZENE | ||
|---|---|---|---|---|
| CAS Number | 13506-78-0 | Molecular Weight | 370.89700 | |
| Density | 2.357g/cm3 | Boiling Point | 283.1ºC at 760mmHg | |
| Molecular Formula | C6HBr2N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125ºC | |
| Name | 2,4-dibromo-1,3,5-trinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.357g/cm3 |
|---|---|
| Boiling Point | 283.1ºC at 760mmHg |
| Molecular Formula | C6HBr2N3O6 |
| Molecular Weight | 370.89700 |
| Flash Point | 125ºC |
| Exact Mass | 368.82300 |
| PSA | 137.46000 |
| LogP | 4.50580 |
| Vapour Pressure | 0.00552mmHg at 25°C |
| Index of Refraction | 1.706 |
| InChIKey | WTHRTSHMOCVSMH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Br)c([N+](=O)[O-])c1Br |
| HS Code | 2904909090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 5 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,2,4-dibromo-1,3,5-trinitro |
| 1,3-DIBROMO-2,4,6-TRINITROBENZENE |
| 2,4-dibromo-1,3,5-trinitro-benzene |
| 1,3-Dibromo-2,4,6-trinitrobenzol |
| 2,4-Dibrom-1,3,5-trinitro-benzol |