Bis-methacrylate-PEG5
Modify Date: 2025-09-21 14:45:31
Bis-methacrylate-PEG5 structure
|
Common Name | Bis-methacrylate-PEG5 | ||
|---|---|---|---|---|
| CAS Number | 13497-24-0 | Molecular Weight | 374.42600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H30O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bis-methacrylate-PEG5Bis-methacrylate-PEG5 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | tetraethyleneglycol dimethacrylate |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-methacrylate-PEG5 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C18H30O8 |
|---|---|
| Molecular Weight | 374.42600 |
| Exact Mass | 374.19400 |
| PSA | 89.52000 |
| LogP | 1.29140 |
| InChIKey | HQKURBRFOOUSNI-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCOCCOCCOCCOCCOC(=O)C(=C)C |
| pentaethylene glycol dimethacrylate |