N-[2-(4,5-Dihydro-2-oxazolyl)-1H-indol-5-yl]acetamide structure
|
Common Name | N-[2-(4,5-Dihydro-2-oxazolyl)-1H-indol-5-yl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 1349698-40-3 | Molecular Weight | 243.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(4,5-Dihydro-2-oxazolyl)-1H-indol-5-yl]acetamide |
|---|
| Molecular Formula | C13H13N3O2 |
|---|---|
| Molecular Weight | 243.26 |
| InChIKey | BPAGZGRJYMKXTM-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc2[nH]c(C3=NCCO3)cc2c1 |
|
Name: Inhibition of human recombinant MMP2 after 30 mins by fluorimetry
Source: ChEMBL
Target: 72 kDa type IV collagenase
External Id: CHEMBL1942129
|
|
Name: Inhibition of human MMP13 expressed in Escherichia coli after 30 mins by fluorimetry
Source: ChEMBL
Target: Collagenase 3
External Id: CHEMBL1942128
|
|
Name: Inhibition of human recombinant MMP14 after 60 mins by fluorimetry
Source: ChEMBL
Target: Matrix metalloproteinase-14
External Id: CHEMBL1942130
|