3-carboxy-5-methyl-N-(4-(trifluoromethyl)phenyl)-4-isoxazolecarboxamide
Modify Date: 2024-07-18 16:06:00
3-carboxy-5-methyl-N-(4-(trifluoromethyl)phenyl)-4-isoxazolecarboxamide structure
|
Common Name | 3-carboxy-5-methyl-N-(4-(trifluoromethyl)phenyl)-4-isoxazolecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 134888-93-0 | Molecular Weight | 314.21700 | |
| Density | 1.52g/cm3 | Boiling Point | 396.2ºC at 760mmHg | |
| Molecular Formula | C13H9F3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.4ºC | |
| Name | 5-methyl-4-[[4-(trifluoromethyl)phenyl]carbamoyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 396.2ºC at 760mmHg |
| Molecular Formula | C13H9F3N2O4 |
| Molecular Weight | 314.21700 |
| Flash Point | 193.4ºC |
| Exact Mass | 314.05100 |
| PSA | 92.43000 |
| LogP | 3.02530 |
| Vapour Pressure | 5.47E-07mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | QREXMXPNUAJXOG-UHFFFAOYSA-N |
| SMILES | Cc1onc(C(=O)O)c1C(=O)Nc1ccc(C(F)(F)F)cc1 |
|
~85%
3-carboxy-5-met... CAS#:134888-93-0 |
| Literature: Patterson; Cheung; Ernest Journal of Medicinal Chemistry, 1992 , vol. 35, # 3 p. 507 - 510 |
| CMTPI |
| 3-Isoxazolecarboxylicacid,5-methyl-4-[[[4-(trifluoromethyl)phenyl]amino]carbonyl] |
| 3-Carboxy-5-methyl-N-(4-(trifluoromethyl)phenyl)-4-isoxazolecarboxamide |