(E)-alpha-bergamotene
Modify Date: 2025-08-20 10:23:20
(E)-alpha-bergamotene structure
|
Common Name | (E)-alpha-bergamotene | ||
|---|---|---|---|---|
| CAS Number | 13474-59-4 | Molecular Weight | 204.35100 | |
| Density | 0.881g/cm3 | Boiling Point | 259.5ºC at 760mmHg | |
| Molecular Formula | C15H24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 100.6ºC | |
| Name | (1S,5S)-4,6-dimethyl-6-(4-methylpent-3-enyl)bicyclo[3.1.1]hept-3-ene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.881g/cm3 |
|---|---|
| Boiling Point | 259.5ºC at 760mmHg |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35100 |
| Flash Point | 100.6ºC |
| Exact Mass | 204.18800 |
| LogP | 4.72520 |
| Index of Refraction | 1.489 |
| InChIKey | YMBFCQPIMVLNIU-SOUVJXGZSA-N |
| SMILES | CC(C)=CCCC1(C)C2CC=C(C)C1C2 |
|
~54%
(E)-alpha-berga... CAS#:13474-59-4 |
| Literature: Journal of Organic Chemistry, , vol. 53, # 19 p. 4508 - 4515 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Norpinene,2,6-dimethyl-6-(4-methyl-3-pentenyl)-,trans-(-) |