4-Cyclohexene-1,2-dicarboxylicacid, 4-methyl- structure
|
Common Name | 4-Cyclohexene-1,2-dicarboxylicacid, 4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 13468-88-7 | Molecular Weight | 184.18900 | |
| Density | 1.295g/cm3 | Boiling Point | 392.8ºC at 760mmHg | |
| Molecular Formula | C9H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.5ºC | |
| Name | 4-methylcyclohex-4-ene-1,2-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.295g/cm3 |
|---|---|
| Boiling Point | 392.8ºC at 760mmHg |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.18900 |
| Flash Point | 205.5ºC |
| Exact Mass | 184.07400 |
| PSA | 74.60000 |
| LogP | 1.12810 |
| Vapour Pressure | 2.9E-07mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | YZPUIHVHPSUCHD-UHFFFAOYSA-N |
| SMILES | CC1=CCC(C(=O)O)C(C(=O)O)C1 |
| HS Code | 2917209090 |
|---|
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 4-Methyl-trans-4-cyclohexen-1,2-dicarbonsaeure |
| (+/-)-trans-4-Methyl-cyclohex-4-en-1,2-dicarbonsaeure |
| (+-)-trans-4-methyl-cyclohex-4-ene-1,2-dicarboxylic acid |
| trans-4,6-Methylcyclohex-4-endicarbonsaeure |