3-(4-Chlorophenyl)-4-hydroxybutyric Acid SodiuM Salt structure
|
Common Name | 3-(4-Chlorophenyl)-4-hydroxybutyric Acid SodiuM Salt | ||
|---|---|---|---|---|
| CAS Number | 1346603-21-1 | Molecular Weight | 238.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12ClNaO3 | Melting Point | 168-170?C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-Chlorophenyl)-4-hydroxybutyric Acid SodiuM Salt |
|---|
| Melting Point | 168-170?C |
|---|---|
| Molecular Formula | C10H12ClNaO3 |
| Molecular Weight | 238.64 |
| Appearance of Characters | Solid | White to Off-White |
| InChIKey | YNPCWJFLKBMRIL-UHFFFAOYSA-M |
| SMILES | O=C([O-])CC(CO)c1ccc(Cl)cc1.[Na+] |
| Storage condition | -20°C Freezer |
| Water Solubility | DMSO, Methanol, Water |