2-[(2-Aminophenyl)[3-(methylamino)propyl]amino]benzoic acid methyl ester
Modify Date: 2025-11-26 01:07:13
![2-[(2-Aminophenyl)[3-(methylamino)propyl]amino]benzoic acid methyl ester Structure](https://image.chemsrc.com/caspic/221/13450-71-0.png)
2-[(2-Aminophenyl)[3-(methylamino)propyl]amino]benzoic acid methyl ester structure
|
Common Name | 2-[(2-Aminophenyl)[3-(methylamino)propyl]amino]benzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 13450-71-0 | Molecular Weight | 313.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-[2-amino-N-[3-(methylamino)propyl]anilino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H23N3O2 |
|---|---|
| Molecular Weight | 313.39400 |
| Exact Mass | 313.17900 |
| PSA | 67.59000 |
| LogP | 3.77510 |
| InChIKey | BXENWNJCBCMLPI-UHFFFAOYSA-N |
| SMILES | CNCCCN(c1ccccc1N)c1ccccc1C(=O)OC |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Anthranilic acid,N-(o-aminophenyl)-N-[3-(methylamino)propyl]-,methyl ester |
| 2-[(2-Aminophenyl)[3-(methylamino)propyl]amino]benzoic acid methyl ester |
| Benzoic acid,2-[(2-aminophenyl)[3-(methylamino)propyl]amino]-,methyl ester |