2-(3-chlorobenzoyl)benzoic acid structure
|
Common Name | 2-(3-chlorobenzoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 13450-37-8 | Molecular Weight | 260.67200 | |
| Density | 1.357g/cm3 | Boiling Point | 474.8ºC at 760 mmHg | |
| Molecular Formula | C14H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241ºC | |
| Name | 2-(3-chlorobenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.357g/cm3 |
|---|---|
| Boiling Point | 474.8ºC at 760 mmHg |
| Molecular Formula | C14H9ClO3 |
| Molecular Weight | 260.67200 |
| Flash Point | 241ºC |
| Exact Mass | 260.02400 |
| PSA | 54.37000 |
| LogP | 3.26920 |
| Vapour Pressure | 8E-10mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | FSMXJLAATHSRCB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)c1cccc(Cl)c1 |
| HS Code | 2918300090 |
|---|
|
~56%
2-(3-chlorobenz... CAS#:13450-37-8 |
| Literature: Seo, Sangwon; Slater, Mark; Greaney, Michael F. Organic Letters, 2012 , vol. 14, # 10 p. 2650 - 2653 |
|
~49%
2-(3-chlorobenz... CAS#:13450-37-8 |
| Literature: Miao, Jinmin; Ge, Haibo Organic Letters, 2013 , vol. 15, # 12 p. 2930 - 2933 |
|
~%
2-(3-chlorobenz... CAS#:13450-37-8 |
| Literature: I.G. Farbenind. Patent: DE621980 , 1933 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 22, p. 244 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3'-Chlorbenzophenon-2-carbonsaeure |
| 2-(3-Chloro-benzoyl)-benzoic acid |
| 4-chloro-2-benzoyl benzoic acid |
| 2-(3-Chlor-benzoyl)-benzoesaeure |
| o-(3-chloro-benzoyl)-benzoic acid |
| EINECS 236-606-9 |