Pamozirine
Modify Date: 2025-08-21 22:14:57
Pamozirine structure
|
Common Name | Pamozirine | ||
|---|---|---|---|---|
| CAS Number | 1343476-98-1 | Molecular Weight | 1115.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C59H70N8O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Pamozirine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C59H70N8O14 |
|---|---|
| Molecular Weight | 1115.2 |
| InChIKey | NHCHEHNZXVUCNF-PPNZEHHTSA-N |
| SMILES | COc1cc2c(cc1OCCCCCOc1cc3c(cc1OC)C(=O)N1C=C(C)CC1C(O)N3C(=O)OCc1ccc(NC(=O)C(C)NC(=O)C(NC(=O)CCCCCN3C(=O)C=CC3=O)C(C)C)cc1)N=CC1CC(C)=CN1C2=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Pamozirine? |
| A: InChIKey of Pamozirine is NHCHEHNZXVUCNF-PPNZEHHTSA-N. |
| Q: What is the molecular weight of Pamozirine? |
| A: Molecular weight of Pamozirine is 1115.2. |
| Q: What is the English name of Pamozirine? |
| A: The English name of Pamozirine is Pamozirine. |
| Q: What is the CAS number of Pamozirine? |
| A: CAS number of Pamozirine is 1343476-98-1. |
| Q: What is the molecular formula of Pamozirine? |
| A: Molecular formula of Pamozirine is C59H70N8O14. |
| Q: What is the SMILES notation of Pamozirine? |
| A: SMILES notation of Pamozirine is COc1cc2c(cc1OCCCCCOc1cc3c(cc1OC)C(=O)N1C=C(C)CC1C(O)N3C(=O)OCc1ccc(NC(=O)C(C)NC(=O)C(NC(=O)CCCCCN3C(=O)C=CC3=O)C(C)C)cc1)N=CC1CC(C)=CN1C2=O. |
| Q: What is the Chinese name of 1343476-98-1? |
| A: Chinese name of 1343476-98-1 is 1343476-98-1. |