1-amino-2,4-dichloroanthraquinone structure
|
Common Name | 1-amino-2,4-dichloroanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 13432-32-1 | Molecular Weight | 292.11700 | |
| Density | 1.576g/cm3 | Boiling Point | 527.9ºC at 760 mmHg | |
| Molecular Formula | C14H7Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.1ºC | |
| Name | 1-amino-2,4-dichloroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.576g/cm3 |
|---|---|
| Boiling Point | 527.9ºC at 760 mmHg |
| Molecular Formula | C14H7Cl2NO2 |
| Molecular Weight | 292.11700 |
| Flash Point | 273.1ºC |
| Exact Mass | 290.98500 |
| PSA | 60.16000 |
| LogP | 3.93220 |
| Vapour Pressure | 3.13E-11mmHg at 25°C |
| Index of Refraction | 1.713 |
| InChIKey | HVNFHSIIPHSECS-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc(Cl)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
|
~%
1-amino-2,4-dic... CAS#:13432-32-1 |
| Literature: US2128178 , ; |
|
~%
1-amino-2,4-dic... CAS#:13432-32-1 |
| Literature: Proceedings - Indian Academy of Sciences, Section A, , vol. 28, p. 236,248 |
|
~%
1-amino-2,4-dic... CAS#:13432-32-1 |
| Literature: DE203083 ; DE115048 ; |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-Amino-2,4-dichloro-anthrachinon |
| 1-Amino-2,4-dichloroanthraquinone |
| 1-amino-2,6-dichloroanthraquinone |
| 1-Amino-2,4-dichlor-anthrachinon |
| F1091-0014 |
| 2,4-Dichloro-1-aminoanthrachinon |
| 2,4-dichloro-1-aminoanthraquinone |
| 1-amino-2,4-dichloroanthra-9,10-quinone |