hexamethylenetetramine, compound with resorcinol structure
|
Common Name | hexamethylenetetramine, compound with resorcinol | ||
|---|---|---|---|---|
| CAS Number | 13423-47-7 | Molecular Weight | 250.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | hexamethylenetetramine, compound with resorcinol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18N4O2 |
|---|---|
| Molecular Weight | 250.29700 |
| Exact Mass | 250.14300 |
| PSA | 53.42000 |
| InChIKey | CIMLIXQVXBAFPF-UHFFFAOYSA-N |
| SMILES | C1N2CN3CN1CN(C2)C3.Oc1cccc(O)c1 |
| Hexamethylentetramin, Verbindung mit Resorcin |
| Hexamethylentetramin*Resorcin |
| 1,3,5,7-Tetraaza-tricyclo[3.3.1.13,7]decane |
| compound with benzene-1,3-diol |