Hydrazinecarboxylicacid, 2-(4-nitrophenyl)-, methyl ester
Modify Date: 2025-08-25 13:58:50
Hydrazinecarboxylicacid, 2-(4-nitrophenyl)-, methyl ester structure
|
Common Name | Hydrazinecarboxylicacid, 2-(4-nitrophenyl)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 13413-36-0 | Molecular Weight | 211.17500 | |
| Density | 1.412g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl N-(4-nitroanilino)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.412g/cm3 |
|---|---|
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.17500 |
| Exact Mass | 211.05900 |
| PSA | 96.18000 |
| LogP | 2.26480 |
| Index of Refraction | 1.618 |
| InChIKey | SCEGCLQQOMZTSX-UHFFFAOYSA-N |
| SMILES | COC(=O)NNc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| p-Nitro-phenylhydrazinameisensaeure-methylester |