(2,4-Dichloropyridin-3-yl)(phenyl)methanone structure
|
Common Name | (2,4-Dichloropyridin-3-yl)(phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 134031-25-7 | Molecular Weight | 252.09600 | |
| Density | 1.365g/cm3 | Boiling Point | 381.7ºC at 760 mmHg | |
| Molecular Formula | C12H7Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.7ºC | |
| Name | (2,4-dichloropyridin-3-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.365g/cm3 |
|---|---|
| Boiling Point | 381.7ºC at 760 mmHg |
| Molecular Formula | C12H7Cl2NO |
| Molecular Weight | 252.09600 |
| Flash Point | 184.7ºC |
| Exact Mass | 250.99000 |
| PSA | 29.96000 |
| LogP | 3.61940 |
| Vapour Pressure | 4.96E-06mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | MXMUPWBBSLEKBP-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1c(Cl)ccnc1Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2,4-dichloropyridin-3-yl)(phenyl)methanone |
| 3-benzoyl-2,4-dichloropyridine |