3,5-Bis((tert-butoxycarbonyl)amino)benzoic acid
Modify Date: 2025-08-27 18:00:07
3,5-Bis((tert-butoxycarbonyl)amino)benzoic acid structure
|
Common Name | 3,5-Bis((tert-butoxycarbonyl)amino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 133887-83-9 | Molecular Weight | 352.382 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 419.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C17H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.6±27.3 °C | |
| Name | 3,5-Bis((tert-butoxycarbonyl)amino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.6±40.0 °C at 760 mmHg |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.382 |
| Flash Point | 207.6±27.3 °C |
| Exact Mass | 352.163422 |
| PSA | 113.96000 |
| LogP | 4.70 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | SSZRVVHPLPWQCW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cc(NC(=O)OC(C)(C)C)cc(C(=O)O)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid, 3,5-bis[[(1,1-dimethylethoxy)carbonyl]amino]- |
| 3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| 3,5-Bis({[(2-methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid |