2-(3-chloro-4-cyclohexyl-phenyl)propanoic acid
Modify Date: 2024-04-04 12:03:27
2-(3-chloro-4-cyclohexyl-phenyl)propanoic acid structure
|
Common Name | 2-(3-chloro-4-cyclohexyl-phenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 13376-38-0 | Molecular Weight | 266.76300 | |
| Density | 1.173g/cm3 | Boiling Point | 383.5ºC at 760mmHg | |
| Molecular Formula | C15H19ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.8ºC | |
| Name | 2-(3-chloro-4-cyclohexylphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 383.5ºC at 760mmHg |
| Molecular Formula | C15H19ClO2 |
| Molecular Weight | 266.76300 |
| Flash Point | 185.8ºC |
| Exact Mass | 266.10700 |
| PSA | 37.30000 |
| LogP | 4.57580 |
| Vapour Pressure | 1.44E-06mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | ZJHLDHTYKGIXJG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1ccc(C2CCCCC2)c(Cl)c1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(3-chloro-4-cyclohexylphenyl)propionic acid |
| (+-)-2-(3-chloro-4-cyclohexylphenyl) propanoic acid |
| (3-Chloro-4-cyclohexylphenyl)propionic acid |
| 3-chloro-4-cyclohexylhydratropic acid |