N-[2-(4-chlorophenyl)quinolin-4-yl]-N',N'-dimethylethane-1,2-diamine structure
|
Common Name | N-[2-(4-chlorophenyl)quinolin-4-yl]-N',N'-dimethylethane-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 133671-47-3 | Molecular Weight | 325.83500 | |
| Density | 1.205g/cm3 | Boiling Point | 499ºC at 760 mmHg | |
| Molecular Formula | C19H20ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.6ºC | |
| Name | N-[2-(4-chlorophenyl)quinolin-4-yl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 499ºC at 760 mmHg |
| Molecular Formula | C19H20ClN3 |
| Molecular Weight | 325.83500 |
| Flash Point | 255.6ºC |
| Exact Mass | 325.13500 |
| PSA | 31.39000 |
| LogP | 3.95060 |
| Vapour Pressure | 4.32E-10mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | KJBCLIWQKOBNLG-UHFFFAOYSA-N |
| SMILES | CN(C)CCNc1cc(-c2ccc(Cl)cc2)nc2ccccc12 |
|
~%
N-[2-(4-chlorop... CAS#:133671-47-3 |
| Literature: Strekowski; Mokrosz; Honkan; Czarny; Cegla; Wydra; Patterson; Schinazi Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1739 - 1746 |
|
~%
N-[2-(4-chlorop... CAS#:133671-47-3 |
| Literature: Strekowski; Mokrosz; Honkan; Czarny; Cegla; Wydra; Patterson; Schinazi Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1739 - 1746 |
|
~%
N-[2-(4-chlorop... CAS#:133671-47-3 |
| Literature: Strekowski; Mokrosz; Honkan; Czarny; Cegla; Wydra; Patterson; Schinazi Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1739 - 1746 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,2-Ethanediamine,N'-[2-(4-chlorophenyl)-4-quinolinyl]-N,N-dimethyl |
| N-[2-(Dimethylamino)ethyl]-2-(4-chlorophenyl)quinolin-4-amine |