Angophorol
Modify Date: 2024-01-14 21:53:20
Angophorol structure
|
Common Name | Angophorol | ||
|---|---|---|---|---|
| CAS Number | 133442-54-3 | Molecular Weight | 314.33 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 571.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.5±23.6 °C | |
Use of AngophorolAngophorol is a flavonone compound. Angophorol exerts potential anticancer activity through growth inhibition and apoptosis in K562 cells[1]. |
| Name | Angophorol |
|---|---|
| Synonym | More Synonyms |
| Description | Angophorol is a flavonone compound. Angophorol exerts potential anticancer activity through growth inhibition and apoptosis in K562 cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 571.3±50.0 °C at 760 mmHg |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.33 |
| Flash Point | 211.5±23.6 °C |
| Exact Mass | 314.115417 |
| PSA | 75.99000 |
| LogP | 4.29 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | VWWMSFMNICMFQB-UHFFFAOYSA-N |
| SMILES | COc1c(C)c(O)c2c(c1C)OC(c1ccc(O)cc1)CC2=O |
| 5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxy-6,8-dimethyl-2,3-dihydro-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 2,3-dihydro-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-6,8-dimethyl- |