ethyl 2-(3,4-dimethoxyphenyl)ethylcarbamoylformate structure
|
Common Name | ethyl 2-(3,4-dimethoxyphenyl)ethylcarbamoylformate | ||
|---|---|---|---|---|
| CAS Number | 13326-56-2 | Molecular Weight | 281.30400 | |
| Density | 1.144g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoacetate |
|---|
| Density | 1.144g/cm3 |
|---|---|
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.30400 |
| Exact Mass | 281.12600 |
| PSA | 73.86000 |
| LogP | 1.31650 |
| Index of Refraction | 1.506 |
| InChIKey | QZQCZJGGHQMDTC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)NCCc1ccc(OC)c(OC)c1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |