APAP-Cys
Modify Date: 2025-08-25 10:42:57
APAP-Cys structure
|
Common Name | APAP-Cys | ||
|---|---|---|---|---|
| CAS Number | 1331891-93-0 | Molecular Weight | 384.328 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15F3N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of APAP-Cys3-Cysteinylacetaminophen TFA salt is an acetaminophen-protein adduct formed during the metabolism of acetaminophen. In mice, 3-cysteinylacetaminophen decreases renal glutathione (GSH) levels --- an effect that can be blocked by the γ-glutamyl inhibitor acivicin. |
| Name | S-(5-Acetamido-2-hydroxyphenyl)-L-cysteine trifluoroacetate (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H15F3N2O6S |
|---|---|
| Molecular Weight | 384.328 |
| Exact Mass | 384.060303 |
| InChIKey | PDZGEXMJHANKLR-QRPNPIFTSA-N |
| SMILES | CC(=O)Nc1ccc(O)c(SCC(N)C(=O)O)c1.O=C(O)C(F)(F)F |
| S-(5-Acetamido-2-hydroxyphenyl)-L-cysteine trifluoroacetate (1:1) |
| L-Cysteine, S-[5-(acetylamino)-2-hydroxyphenyl]-, compd. with 2,2,2-trifluoroacetic acid (1:1) |