Olopatadine-d3 (hydrochloride) structure
|
Common Name | Olopatadine-d3 (hydrochloride) | ||
|---|---|---|---|---|
| CAS Number | 1331635-21-2 | Molecular Weight | 376.892 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21D3ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Olopatadine-d3 (hydrochloride)Olopatadine-d3 hydrochloride (ALO4943A-d3) is the deuterium labeled Olopatadine hydrochloride. Olopatadine hydrochloride (ALO4943A) is a histamine blocker used to treat allergic conjunctivitis[1][2]. |
| Name | Olopatadine-d3 (hydrochloride) |
|---|---|
| Synonym | More Synonyms |
| Description | Olopatadine-d3 hydrochloride (ALO4943A-d3) is the deuterium labeled Olopatadine hydrochloride. Olopatadine hydrochloride (ALO4943A) is a histamine blocker used to treat allergic conjunctivitis[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C21H21D3ClNO3 |
|---|---|
| Molecular Weight | 376.892 |
| Exact Mass | 376.163300 |
| InChIKey | HVRLZEKDTUEKQH-KSSVLRJGSA-N |
| SMILES | CN(C)CCC=C1c2ccccc2COc2ccc(CC(=O)O)cc21.Cl |
| Olopatadine-d3 (hydrochloride) |
| Dibenz[b,e]oxepin-2-acetic acid, 6,11-dihydro-11-[3-(methylmethyl-d3-amino)propylidene]-, (11E)-, hydrochloride (1:1) |
| [(11E)-11-(3-{Methyl[(2H3)methyl]amino}propylidene)-6,11-dihydrodibenzo[b,e]oxepin-2-yl]acetic acid hydrochloride (1:1) |