4-aminofenitrothion
Modify Date: 2025-11-30 18:59:02
4-aminofenitrothion structure
|
Common Name | 4-aminofenitrothion | ||
|---|---|---|---|---|
| CAS Number | 13306-69-9 | Molecular Weight | 247.25100 | |
| Density | 1.279g/cm3 | Boiling Point | 333.6ºC at 760 mmHg | |
| Molecular Formula | C9H14NO3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.5ºC | |
| Name | 4-dimethoxyphosphinothioyloxy-2-methylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.279g/cm3 |
|---|---|
| Boiling Point | 333.6ºC at 760 mmHg |
| Molecular Formula | C9H14NO3PS |
| Molecular Weight | 247.25100 |
| Flash Point | 155.5ºC |
| Exact Mass | 247.04300 |
| PSA | 95.61000 |
| LogP | 3.70510 |
| Vapour Pressure | 0.000135mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | MBJWTIDJKMSHDR-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)Oc1ccc(N)c(C)c1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Fenitrothion amino analog |
| AMINOFENITROTHION |
| 4-Aminofenitrothion |
| Aminosumithion |