3-methylaniline; 2,4,6-trinitrophenol structure
|
Common Name | 3-methylaniline; 2,4,6-trinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 13296-85-0 | Molecular Weight | 336.25700 | |
| Density | N/A | Boiling Point | 303.6ºC at 760 mmHg | |
| Molecular Formula | C13H12N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.9ºC | |
| Name | 3-methylaniline,2,4,6-trinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 303.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H12N4O7 |
| Molecular Weight | 336.25700 |
| Flash Point | 133.9ºC |
| Exact Mass | 336.07100 |
| PSA | 183.71000 |
| LogP | 4.84480 |
| Vapour Pressure | 0.000514mmHg at 25°C |
| InChIKey | XGWCPKGQTCXXJQ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N)c1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
|
~%
3-methylaniline... CAS#:13296-85-0 |
| Literature: Polish Journal of Chemistry, , vol. 64, # 1-6 p. 175 - 181 |
|
~%
3-methylaniline... CAS#:13296-85-0 |
| Literature: Polish Journal of Chemistry, , vol. 59, # 3 p. 305 - 310 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| m-Toluidin-pikrat |
| m-Toluidin,Salz des 2.4.6-Trinitro-phenols |
| m-Toluidin,Picrat |
| m-toluidine,picrate |