1,3,3a,4,7,7a-hexahydroindene-2,2-dicarboxylic acid
Modify Date: 2025-09-20 19:40:42
1,3,3a,4,7,7a-hexahydroindene-2,2-dicarboxylic acid structure
|
Common Name | 1,3,3a,4,7,7a-hexahydroindene-2,2-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 13294-98-9 | Molecular Weight | 210.22600 | |
| Density | 1.339g/cm3 | Boiling Point | 419.6ºC at 760mmHg | |
| Molecular Formula | C11H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.7ºC | |
| Name | 1,3,3a,4,7,7a-hexahydroindene-2,2-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 419.6ºC at 760mmHg |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.22600 |
| Flash Point | 221.7ºC |
| Exact Mass | 210.08900 |
| PSA | 74.60000 |
| LogP | 1.51820 |
| Vapour Pressure | 3.24E-08mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | HBIGXAYPFWAMMO-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(C(=O)O)CC2CC=CCC2C1 |
|
~%
1,3,3a,4,7,7a-h... CAS#:13294-98-9 |
| Literature: Ayres; Raphael Journal of the Chemical Society, 1958 , p. 1779,1786 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (+-)-trans-1,3,3a,4,7,7a-hexahydro-indene-2,2-dicarboxylic acid |