sodium (R)-[(3-methoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate
Modify Date: 2025-09-27 14:49:26
![sodium (R)-[(3-methoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate Structure](https://image.chemsrc.com/caspic/321/13291-96-8.png)
sodium (R)-[(3-methoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate structure
|
Common Name | sodium (R)-[(3-methoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate | ||
|---|---|---|---|---|
| CAS Number | 13291-96-8 | Molecular Weight | 271.24400 | |
| Density | N/A | Boiling Point | 418.7ºC at 760mmHg | |
| Molecular Formula | C13H14NNaO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207ºC | |
| Name | sodium (R)-[(3-methoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 418.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C13H14NNaO4 |
| Molecular Weight | 271.24400 |
| Flash Point | 207ºC |
| Exact Mass | 271.08200 |
| PSA | 78.46000 |
| LogP | 0.53490 |
| Vapour Pressure | 9.28E-08mmHg at 25°C |
| InChIKey | VWAWMPXOFHGGMY-UYZIEVLVSA-M |
| SMILES | COC(=O)C=C(C)NC(C(=O)[O-])c1ccccc1.[Na+] |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| SODIUM (R)-N-(3-METHOXY-1-METHYL-3-OXOPROP-1-ENYL)-2-PHENYLGLYCINATE |
| 3-[((R)-carboxy-phenyl-methyl)-amino]-but-2-enoic acid methyl ester,sodium salt |
| D-(-)-Phenylglycene Dane Salt (NA,M) |