2,5-Dihydroxyphenyl(diphenyl)phosphine Oxide
Modify Date: 2025-08-27 07:27:56
2,5-Dihydroxyphenyl(diphenyl)phosphine Oxide structure
|
Common Name | 2,5-Dihydroxyphenyl(diphenyl)phosphine Oxide | ||
|---|---|---|---|---|
| CAS Number | 13291-46-8 | Molecular Weight | 310.28400 | |
| Density | 1.34g/cm3 | Boiling Point | 573.7ºC at 760 mmHg | |
| Molecular Formula | C18H15O3P | Melting Point | 214ºC | |
| MSDS | N/A | Flash Point | 300.7ºC | |
| Name | 2,5-Dihydroxyphenyl(diphenyl)phosphine Oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 573.7ºC at 760 mmHg |
| Melting Point | 214ºC |
| Molecular Formula | C18H15O3P |
| Molecular Weight | 310.28400 |
| Flash Point | 300.7ºC |
| Exact Mass | 310.07600 |
| PSA | 67.34000 |
| LogP | 2.73720 |
| Vapour Pressure | 9.23E-14mmHg at 25°C |
| Index of Refraction | 1.67 |
| InChIKey | LLOXZCFOAUCDAE-UHFFFAOYSA-N |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1cc(O)ccc1O |
| RIDADR | UN 3077 9/PG III |
|---|---|
| Packaging Group | III |
| Hazard Class | 9 |
| HS Code | 2919900090 |
|
~99%
2,5-Dihydroxyph... CAS#:13291-46-8 |
| Literature: Brown, John M.; Woodward, Simon Journal of Organic Chemistry, 1991 , vol. 56, # 24 p. 6803 - 6809 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:72666-56-9| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 2-diphenylphosphorylbenzene-1,4-diol |