1,10-phenanthroline-valine palladium(II) structure
|
Common Name | 1,10-phenanthroline-valine palladium(II) | ||
|---|---|---|---|---|
| CAS Number | 132901-05-4 | Molecular Weight | 403.771 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19N3O2Pd | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | L-Valine, compd. with 1,10-phenanthroline, palladium(2+) salt (1:1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19N3O2Pd |
|---|---|
| Molecular Weight | 403.771 |
| Exact Mass | 403.050110 |
| InChIKey | OBUINYWPYNNTPB-INZIHYEWSA-N |
| SMILES | CC(C)C(N)C(=O)O.[Pd+2].c1cnc2c(c1)ccc1cccnc12 |
| L-Valine, compd. with 1,10-phenanthroline, palladium(2+) salt (1:1:1) |