9,10-anthracenediylbis[triethoxysilane] structure
|
Common Name | 9,10-anthracenediylbis[triethoxysilane] | ||
|---|---|---|---|---|
| CAS Number | 132877-71-5 | Molecular Weight | 502.74700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H38O6Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triethoxy-(10-triethoxysilylanthracen-9-yl)silane |
|---|
| Molecular Formula | C26H38O6Si2 |
|---|---|
| Molecular Weight | 502.74700 |
| Exact Mass | 502.22100 |
| PSA | 55.38000 |
| LogP | 4.50380 |
| InChIKey | UKHSZDXIPCKSPL-UHFFFAOYSA-N |
| SMILES | CCO[Si](OCC)(OCC)c1c2ccccc2c([Si](OCC)(OCC)OCC)c2ccccc12 |
|
~%
9,10-anthracene... CAS#:132877-71-5 |
| Literature: Shea; Loy; Webster Journal of the American Chemical Society, 1992 , vol. 114, # 17 p. 6700 - 6710 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |