N-octanoylglucosylamine
Modify Date: 2025-08-27 12:11:31
N-octanoylglucosylamine structure
|
Common Name | N-octanoylglucosylamine | ||
|---|---|---|---|---|
| CAS Number | 13287-92-8 | Molecular Weight | 305.36700 | |
| Density | 1.24g/cm3 | Boiling Point | 564.7ºC at 760mmHg | |
| Molecular Formula | C14H27NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.3ºC | |
| Name | N-Octanoyl-D-glucopyranosylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 564.7ºC at 760mmHg |
| Molecular Formula | C14H27NO6 |
| Molecular Weight | 305.36700 |
| Flash Point | 295.3ºC |
| Exact Mass | 305.18400 |
| PSA | 122.74000 |
| LogP | 0.10330 |
| Vapour Pressure | 4.21E-15mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | XEPXGZZWVKNRGS-GQYPCLOQSA-N |
| SMILES | CCCCCCCC(=O)NC1OC(CO)C(O)C(O)C1O |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| n-Amyl-acetyl-carbinol |
| 3-hydroxy-2-octanone |
| N-octanoyl-D-glucosamine |
| 3-Hydroxy-octan-2-on |
| hexylmethyl-keton 2,4-dinitrophenylhydrazon |
| 3-hydroxy-octan-2-one |
| octan-2-one-(2,4-dinitro-phenylhydrazone) |
| Octanol-(3)-on-(2) |
| 2-octanone 2,4-dinitrophenylhydrazone |
| 2-octanon-3-ol |
| 2-Octanoylamino-2-desoxy-D-glucose |
| N-D-Glucose-2-yl-octamid |
| Octanon-(2)-<2.4-Dinitro-phenylhydrazon> |
| N-octanoyl-glucosamine |
| 2-Octanone,3-hydroxy |
| Octan-2-on-<2.4-dinitro-phenylhydrazon> |
| Methyl-hexyl-keton-<2.4-dinitro-phenylhydrazon> |
| 2-octanoylamino-2-deoxy-D-glucose |
| 3-Hydroxy-2-octanone [FHFI] |