2,2,4-trimethyl-1,3-pentanediol dimethacrylate structure
|
Common Name | 2,2,4-trimethyl-1,3-pentanediol dimethacrylate | ||
|---|---|---|---|---|
| CAS Number | 13283-44-8 | Molecular Weight | 282.37500 | |
| Density | 0.973g/cm3 | Boiling Point | 342.2ºC at 760 mmHg | |
| Molecular Formula | C16H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.6ºC | |
| Name | 2,2,4-trimethyl-1,3-pentanediol dimethacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.973g/cm3 |
|---|---|
| Boiling Point | 342.2ºC at 760 mmHg |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.37500 |
| Flash Point | 157.6ºC |
| Exact Mass | 282.18300 |
| PSA | 52.60000 |
| LogP | 3.27580 |
| Vapour Pressure | 7.63E-05mmHg at 25°C |
| Index of Refraction | 1.455 |
| InChIKey | TVGGFVNRRGKACD-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(C)(C)C(OC(=O)C(=C)C)C(C)C |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 2-propenoicacid,2-methyl-,2,2-dimethyl-1-(1-methylethyl)-1,3-propanediylest |
| 1-isopropyl-2,2-dimethylpropane-1,3-diyl bismethacrylate |
| Bis(2-methylpropenoic acid)2,2-dimethyl-1-(1-methylethyl)-1,3-propanediyl ester |
| 2,2,4-TRIMETHYL-1,2-DIHYDRO-QUINOLINE |