Sclerin
Modify Date: 2025-08-25 22:27:56
Sclerin structure
|
Common Name | Sclerin | ||
|---|---|---|---|---|
| CAS Number | 13277-76-4 | Molecular Weight | 234.24800 | |
| Density | 1.249g/cm3 | Boiling Point | 433ºC at 760 mmHg | |
| Molecular Formula | C13H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.5ºC | |
| Name | Sclerin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 433ºC at 760 mmHg |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.24800 |
| Flash Point | 168.5ºC |
| Exact Mass | 234.08900 |
| PSA | 63.60000 |
| LogP | 2.11790 |
| Vapour Pressure | 4.17E-08mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | PXPDDNZJJKVTBG-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(O)c2c(c1C)C(C)C(=O)OC2=O |
|
~%
Sclerin CAS#:13277-76-4 |
| Literature: Chan, Tak-Hang; Brownbridge, Peter Journal of the Chemical Society, Chemical Communications, 1981 , # 1 p. 20 - 21 |
|
~%
Sclerin CAS#:13277-76-4 |
| Literature: Brownbridge, P.; Chan, T. H.; Brook, M. A.; Kang, G. J. Canadian Journal of Chemistry, 1983 , vol. 61, p. 688 - 693 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2H-Inden-2-one,1,3-dihydro-4,5,6,7-tetramethyl |
| 4,5,6,7-tetramethyl-1,3-dihydro-inden-2-one |
| 4,5,6,7-Tetramethyl-2-indanon |
| 4,5,6,7-Tetramethylindan-2-on |
| 4,5,6,7-tetramethyl-1,3-dihydro-2H-inden-2-one |
| 4,5,6,7-Tetramethyl-8-hydroxy-isochroman-1,3-dion |
| 8-hydroxy-4,5,6,7-tetramethyl-isochroman-1,3-dione |
| 4,5,6,7-tetramethylindane-2-one |