Urea,N-(2-chlorophenyl)-N'-(2,4-dimethylphenyl)-
Modify Date: 2025-09-13 11:28:32
Urea,N-(2-chlorophenyl)-N'-(2,4-dimethylphenyl)- structure
|
Common Name | Urea,N-(2-chlorophenyl)-N'-(2,4-dimethylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 13257-12-0 | Molecular Weight | 274.74500 | |
| Density | 1.281g/cm3 | Boiling Point | 316.4ºC at 760mmHg | |
| Molecular Formula | C15H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.2ºC | |
| Name | 1-(2-chlorophenyl)-3-(2,4-dimethylphenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 316.4ºC at 760mmHg |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.74500 |
| Flash Point | 145.2ºC |
| Exact Mass | 274.08700 |
| PSA | 41.13000 |
| LogP | 4.74680 |
| Vapour Pressure | 0.00041mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | UZEJGNHLLYAYGU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)Nc2ccccc2Cl)c(C)c1 |
| HS Code | 2924299090 |
|---|
|
~%
Urea,N-(2-chlor... CAS#:13257-12-0 |
| Literature: Sah Journal of the Chinese Chemical Society (Peking), 1946 , vol. 13, p. 22,26,27 Recueil des Travaux Chimiques des Pays-Bas, 1940 , vol. 59, p. 231,233,234 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(2-chloro-phenyl)-N'-(2,4-dimethyl-phenyl)-urea |
| N-(2-Chlor-phenyl)-N'-(2,4-dimethyl-phenyl)-harnstoff |