Solvent Blue 5
Modify Date: 2025-08-21 16:57:11
Solvent Blue 5 structure
|
Common Name | Solvent Blue 5 | ||
|---|---|---|---|---|
| CAS Number | 1325-86-6 | Molecular Weight | 495.698 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 680.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C33H41N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 365.1±31.5 °C | |
| Name | bis[4-(diethylamino)phenyl]-[4-(ethylamino)naphthalen-1-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 680.1±55.0 °C at 760 mmHg |
| Molecular Formula | C33H41N3O |
| Molecular Weight | 495.698 |
| Flash Point | 365.1±31.5 °C |
| Exact Mass | 495.324951 |
| PSA | 38.74000 |
| LogP | 8.07 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | ZDMVLXPCERUWIR-UHFFFAOYSA-N |
| SMILES | CCNc1ccc(C(O)(c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)c2ccccc12 |
| HS Code | 2922199090 |
|---|
|
~%
Solvent Blue 5 CAS#:1325-86-6 |
| Literature: Indian Journal of Chemistry - Section A Inorganic, Physical, Theoretical and Analytical Chemistry, , vol. 39, # 7 p. 703 - 708 |
![[4-[bis[4-(diethylamino)phenyl]methylidene]naphthalen-1-ylidene]-ethylazanium structure](https://image.chemsrc.com/caspic/362/36396-19-7.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Naphthalenemethanol, α,α-bis(4-(diethylamino)phenyl)-4-(ethylamino)- |
| EINECS 215-409-1 |
| Bis[4-(diethylamino)phenyl][4-(ethylamino)-1-naphthyl]methanol |
| Solvent Blue 5 |
| 1-Naphthalenemethanol, α,α-bis[4-(diethylamino)phenyl]-4-(ethylamino)- |
| α,α-Bis(4-(diethylamino)phenyl)-4-(ethylamino)naphthalene-1-methanol |