Propanoicacid, 2-(2-nitrophenoxy)-, ethyl ester structure
|
Common Name | Propanoicacid, 2-(2-nitrophenoxy)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 13212-56-1 | Molecular Weight | 239.22500 | |
| Density | 1.225g/cm3 | Boiling Point | 347.4ºC at 760mmHg | |
| Molecular Formula | C11H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.9ºC | |
| Name | ethyl 2-(2-nitrophenoxy)propanoate |
|---|
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 347.4ºC at 760mmHg |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.22500 |
| Flash Point | 148.9ºC |
| Exact Mass | 239.07900 |
| PSA | 81.35000 |
| LogP | 2.44840 |
| Vapour Pressure | 5.39E-05mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | NYBPNCZBAGRYQA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)Oc1ccccc1[N+](=O)[O-] |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |