2-(3-Chlorophenyl)-thiazole-4-carboxylic acid ethyl ester
Modify Date: 2025-11-27 01:26:38
2-(3-Chlorophenyl)-thiazole-4-carboxylic acid ethyl ester structure
|
Common Name | 2-(3-Chlorophenyl)-thiazole-4-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 132089-34-0 | Molecular Weight | 267.73100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(3-chlorophenyl)-1,3-thiazole-4-carboxylate |
|---|
| Molecular Formula | C12H10ClNO2S |
|---|---|
| Molecular Weight | 267.73100 |
| Exact Mass | 267.01200 |
| PSA | 67.43000 |
| LogP | 3.64020 |
| Index of Refraction | 1.588 |
| InChIKey | HSOTXXRVHCFIHM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1csc(-c2cccc(Cl)c2)n1 |
| HS Code | 2934100090 |
|---|
|
~%
2-(3-Chlorophen... CAS#:132089-34-0 |
| Literature: Zia, Mehwash; Akhtar, Tashfeen; Hameed, Shahid; Al-Masoudi, Najim A. Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2012 , vol. 67, # 7 p. 747 - 758 |
|
~%
2-(3-Chlorophen... CAS#:132089-34-0 |
| Literature: Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, , vol. 67, # 7 p. 747 - 758 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |