Urea,N-(3-chlorophenyl)-N'-(3,4-dimethylphenyl)-
Modify Date: 2025-08-28 21:18:36
Urea,N-(3-chlorophenyl)-N'-(3,4-dimethylphenyl)- structure
|
Common Name | Urea,N-(3-chlorophenyl)-N'-(3,4-dimethylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 13208-29-2 | Molecular Weight | 274.74500 | |
| Density | 1.281g/cm3 | Boiling Point | 325.8ºC at 760mmHg | |
| Molecular Formula | C15H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.8ºC | |
| Name | 1-(3-chlorophenyl)-3-(3,4-dimethylphenyl)urea |
|---|
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 325.8ºC at 760mmHg |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.74500 |
| Flash Point | 150.8ºC |
| Exact Mass | 274.08700 |
| PSA | 41.13000 |
| LogP | 4.74680 |
| Vapour Pressure | 0.000226mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | DIAVHLUOVTVKEF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)Nc2cccc(Cl)c2)cc1C |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:95-64-7
CAS#:2909-38-8| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |