N-(2,5-Dimethoxyphenyl)-2-hydroxydibenzofuran-3-carboxamide structure
|
Common Name | N-(2,5-Dimethoxyphenyl)-2-hydroxydibenzofuran-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 132-62-7 | Molecular Weight | 363.36300 | |
| Density | 1.367g/cm3 | Boiling Point | 503.9ºC at 760mmHg | |
| Molecular Formula | C21H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.5ºC | |
| Name | N-(2,5-Dimethoxyphenyl)-2-hydroxydibenzofuran-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367g/cm3 |
|---|---|
| Boiling Point | 503.9ºC at 760mmHg |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.36300 |
| Flash Point | 258.5ºC |
| Exact Mass | 363.11100 |
| PSA | 80.93000 |
| LogP | 4.63410 |
| Vapour Pressure | 8.91E-11mmHg at 25°C |
| Index of Refraction | 1.711 |
| InChIKey | IWWAOEHIGYWDRA-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(NC(=O)c2cc3oc4ccccc4c3cc2O)c1 |
| HS Code | 2932999099 |
|---|
|
~%
N-(2,5-Dimethox... CAS#:132-62-7 |
| Literature: DE607381 , ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 21, p. 275 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-hydroxy-dibenzofuran-3-carboxylic acid-(2,5-dimethoxy-anilide) |
| Naphthol AS-DB |
| 2-Hydroxy-dibenzofuran-3-carbonsaeure-(2,5-dimethoxy-anilid) |
| Naphtanilide BT |
| 2-hydroxy-2',5'-dimethoxydibenzofuran-3-carboxanilide |
| Naphthanil DB |
| C.I. Azoic Coupling Component 16 |
| 3-Dibenzofurancarboxamide,N-(2,5-dimethoxyphenyl)-2-hydroxy |
| EINECS 205-069-2 |
| Naphthol AS-BT |