4H-1-Benzopyran-4-one,3,6-dichloro-2-phenyl-
Modify Date: 2025-11-25 13:55:39
4H-1-Benzopyran-4-one,3,6-dichloro-2-phenyl- structure
|
Common Name | 4H-1-Benzopyran-4-one,3,6-dichloro-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 13179-00-5 | Molecular Weight | 291.12900 | |
| Density | 1.46g/cm3 | Boiling Point | 412.3ºC at 760 mmHg | |
| Molecular Formula | C15H8Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.8ºC | |
| Name | 3,6-dichloro-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 412.3ºC at 760 mmHg |
| Molecular Formula | C15H8Cl2O2 |
| Molecular Weight | 291.12900 |
| Flash Point | 169.8ºC |
| Exact Mass | 289.99000 |
| PSA | 30.21000 |
| LogP | 4.76680 |
| Vapour Pressure | 5.22E-07mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | PTNKLWUWHUGKTA-UHFFFAOYSA-N |
| SMILES | O=c1c(Cl)c(-c2ccccc2)oc2ccc(Cl)cc12 |
|
~9%
4H-1-Benzopyran... CAS#:13179-00-5 |
| Literature: Karton, Yishai; Jiang, Ji-Long; Ji, Xiao-Duo; Melman, Neli; Olah, Mark E.; Stiles, Gary L.; Jacobson, Kenneth A. Journal of Medicinal Chemistry, 1996 , vol. 39, # 12 p. 2293 - 2301 |
|
~%
4H-1-Benzopyran... CAS#:13179-00-5 |
| Literature: Karton, Yishai; Jiang, Ji-Long; Ji, Xiao-Duo; Melman, Neli; Olah, Mark E.; Stiles, Gary L.; Jacobson, Kenneth A. Journal of Medicinal Chemistry, 1996 , vol. 39, # 12 p. 2293 - 2301 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6,3-Dichlorflavon |
| 3,6-Dichloroflavone |
| 3,6-dichloro-2-phenyl-chromen-4-one |
| 3,6-Dichlor-flavon |
| 3,6-dichloro-2-phenyl-4h-chromen-4-one |