6-amino-5-propyl-2-sulfanylidene-3H-pyrimidine-4-carboxylic acid structure
|
Common Name | 6-amino-5-propyl-2-sulfanylidene-3H-pyrimidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 13164-79-9 | Molecular Weight | 213.25700 | |
| Density | 1.5g/cm3 | Boiling Point | 375ºC at 760 mmHg | |
| Molecular Formula | C8H11N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.6ºC | |
| Name | 4-amino-5-propyl-2-sulfanylidene-1H-pyrimidine-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 375ºC at 760 mmHg |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.25700 |
| Flash Point | 180.6ºC |
| Exact Mass | 213.05700 |
| PSA | 124.09000 |
| LogP | 1.95330 |
| Vapour Pressure | 1.18E-06mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | BXDQGMQFXSGRRB-UHFFFAOYSA-N |
| SMILES | CCCc1c(N)nc(=S)[nH]c1C(=O)O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-amino-5-propyl-2-thioxo-1,2-dihydro-pyrimidine-4-carboxylic acid |
| 6-amino-5-propyl-2-sulfanylidene-3H-pyrimidine-4-carboxylic acid |
| 5-Propyl-2-mercapto-6-amino-4-carboxypyrimidin |