6-AMINO-5-BROMO-1-ETHYLPYRIMIDINE-2,4(1H,3H)-DIONE structure
|
Common Name | 6-AMINO-5-BROMO-1-ETHYLPYRIMIDINE-2,4(1H,3H)-DIONE | ||
|---|---|---|---|---|
| CAS Number | 131598-61-3 | Molecular Weight | 234.05100 | |
| Density | 1.729g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H8BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-amino-5-bromo-1-ethylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.729g/cm3 |
|---|---|
| Molecular Formula | C6H8BrN3O2 |
| Molecular Weight | 234.05100 |
| Exact Mass | 232.98000 |
| PSA | 81.14000 |
| LogP | 0.89470 |
| Index of Refraction | 1.593 |
| InChIKey | DVZWWTRLSAYQKE-UHFFFAOYSA-N |
| SMILES | CCn1c(N)c(Br)c(=O)[nH]c1=O |
| HS Code | 2933599090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms2668k11 |