ethyl 4-hydroxy-5-oxo-1-(thiophen-2-ylmethyl)-2H-pyrrole-3-carboxylate structure
|
Common Name | ethyl 4-hydroxy-5-oxo-1-(thiophen-2-ylmethyl)-2H-pyrrole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 131436-78-7 | Molecular Weight | 267.30100 | |
| Density | 1.449g/cm3 | Boiling Point | 489.5ºC at 760mmHg | |
| Molecular Formula | C12H13NO4S | Melting Point | 98-100ºC | |
| MSDS | N/A | Flash Point | 249.8ºC | |
| Name | ethyl 4-hydroxy-5-oxo-1-(thiophen-2-ylmethyl)-2H-pyrrole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.449g/cm3 |
|---|---|
| Boiling Point | 489.5ºC at 760mmHg |
| Melting Point | 98-100ºC |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.30100 |
| Flash Point | 249.8ºC |
| Exact Mass | 267.05700 |
| PSA | 95.08000 |
| LogP | 1.40340 |
| Vapour Pressure | 2.14E-10mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | LCDLJTYTVMVKMU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(O)C(=O)N(Cc2cccs2)C1 |
| HS Code | 2934999090 |
|---|
|
~%
ethyl 4-hydroxy... CAS#:131436-78-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 34, # 3 p. 1011 - 1018 |
|
~32%
ethyl 4-hydroxy... CAS#:131436-78-7 |
| Literature: Mylari; Beyer; Siegel Journal of Medicinal Chemistry, 1991 , vol. 34, # 3 p. 1011 - 1018 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 4-hydroxy-5-oxo-1-(2-thienylmethyl)-2,5-dihydro-1H-pyrrole-3-carboxylate |
| 1H-Pyrrole-3-carboxylicacid,2,5-dihydro-4-hydroxy-5-oxo-1-(2-thienylmethyl)-,ethyl ester |