N-phenylacetyl-4-nitroaniline structure
|
Common Name | N-phenylacetyl-4-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 13140-77-7 | Molecular Weight | 256.25700 | |
| Density | 1.313g/cm3 | Boiling Point | 506.1ºC at 760mmHg | |
| Molecular Formula | C14H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.9ºC | |
| Name | N-(4-nitrophenyl)-2-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.313g/cm3 |
|---|---|
| Boiling Point | 506.1ºC at 760mmHg |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.25700 |
| Flash Point | 259.9ºC |
| Exact Mass | 256.08500 |
| PSA | 74.92000 |
| LogP | 3.37220 |
| Vapour Pressure | 2.29E-10mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | JYDFOXZALFOSJF-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)Nc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Phenylacetic acid p-nitroanilide |
| N-Phenylacetyl-4-nitroaniline |
| N-Phenylacetyl-p-nitroaniline |