c-Fms-IN-7 structure
|
Common Name | c-Fms-IN-7 | ||
|---|---|---|---|---|
| CAS Number | 1313408-89-7 | Molecular Weight | 468.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H24N6OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of c-Fms-IN-7c-Fms-IN-7 is a cFMS inhibitor extracted from patent WO2011079076A1, example159, has an IC50 of 18.5 nM[1]. |
| Name | c-Fms-IN-7 |
|---|
| Description | c-Fms-IN-7 is a cFMS inhibitor extracted from patent WO2011079076A1, example159, has an IC50 of 18.5 nM[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H24N6OS |
|---|---|
| Molecular Weight | 468.57 |
| InChIKey | FTZFXXAIYXWZLT-UHFFFAOYSA-N |
| SMILES | CSc1ccn2c(C(=O)Nc3cccc4c3c(C3CC3)nn4Cc3cccc(C)n3)cnc2c1 |