methyl 2-acetamido-3-(2-naphthyl)propenoate structure
|
Common Name | methyl 2-acetamido-3-(2-naphthyl)propenoate | ||
|---|---|---|---|---|
| CAS Number | 131305-19-6 | Molecular Weight | 269.29500 | |
| Density | 1.206g/cm3 | Boiling Point | 518.3ºC at 760mmHg | |
| Molecular Formula | C16H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.2ºC | |
| Name | methyl 2-acetamido-3-(2-naphthyl)propenoate |
|---|
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 518.3ºC at 760mmHg |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.29500 |
| Flash Point | 267.2ºC |
| Exact Mass | 269.10500 |
| PSA | 55.40000 |
| LogP | 2.88070 |
| Vapour Pressure | 7.6E-11mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | KYXZNCZFSIHSMV-XNTDXEJSSA-N |
| SMILES | COC(=O)C(=Cc1ccc2ccccc2c1)NC(C)=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |