2,6-Dichloro-9-isopropyl-8-methyl-9H-purine
Modify Date: 2025-09-11 15:41:08
2,6-Dichloro-9-isopropyl-8-methyl-9H-purine structure
|
Common Name | 2,6-Dichloro-9-isopropyl-8-methyl-9H-purine | ||
|---|---|---|---|---|
| CAS Number | 1313026-86-6 | Molecular Weight | 245.109 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H10Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dichloro-8-methyl-9-propan-2-ylpurine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C9H10Cl2N4 |
| Molecular Weight | 245.109 |
| Exact Mass | 244.028259 |
| PSA | 43.60000 |
| LogP | 2.37 |
| Index of Refraction | 1.676 |
| InChIKey | CAZPSBRBADZWAY-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(Cl)nc(Cl)nc2n1C(C)C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-Dichloro-9-isopropyl-8-methyl-9H-purine |
| 9H-Purine, 2,6-dichloro-8-methyl-9-(1-methylethyl)- |