2-(3,4-dichlorophenyl)-5-methyl-4H-pyrazol-3-one
Modify Date: 2025-09-15 18:39:30
2-(3,4-dichlorophenyl)-5-methyl-4H-pyrazol-3-one structure
|
Common Name | 2-(3,4-dichlorophenyl)-5-methyl-4H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 13124-17-9 | Molecular Weight | 243.08900 | |
| Density | 1.45g/cm3 | Boiling Point | 426.8ºC at 760 mmHg | |
| Molecular Formula | C10H8Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.9ºC | |
| Name | 2-(3,4-dichlorophenyl)-5-methyl-4H-pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 426.8ºC at 760 mmHg |
| Molecular Formula | C10H8Cl2N2O |
| Molecular Weight | 243.08900 |
| Flash Point | 211.9ºC |
| Exact Mass | 242.00100 |
| PSA | 37.79000 |
| LogP | 2.78080 |
| Vapour Pressure | 1.72E-07mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | NPLZMVKJNPOHRL-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2ccc(Cl)c(Cl)c2)C(=O)C1 |
| HS Code | 2933199090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:141-97-9
CAS#:13124-18-0| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3,4-dichlorophenyl)-5-methyl-2,4-dihydropyrazol-3-one |
| 2-(3,4-dichlorophenyl)-5-methyl-2,4-dihydro-3h-pyrazol-3-one |
| 2-(3,4-Dichlorophenyl)-2,4-dihydro-5-methyl-3H-pyrazol-3-one |
| EINECS 236-055-4 |
| 1-(3,4-dichlorophenyl)-3-methyl-2-pyrazolin-5-one |
| 3-methyl-1-(3',4'-dichlorophenyl)-2-pyrazolin-5-one |