Urea,N-(2,3-dimethylphenyl)-N'-phenyl- structure
|
Common Name | Urea,N-(2,3-dimethylphenyl)-N'-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 13114-76-6 | Molecular Weight | 240.30000 | |
| Density | 1.187g/cm3 | Boiling Point | 296ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.5ºC | |
| Name | 1-(2,3-dimethylphenyl)-3-phenylurea |
|---|
| Density | 1.187g/cm3 |
|---|---|
| Boiling Point | 296ºC at 760 mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30000 |
| Flash Point | 95.5ºC |
| Exact Mass | 240.12600 |
| PSA | 41.13000 |
| LogP | 4.09340 |
| Vapour Pressure | 0.00148mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | HJFLYCQWMZVXGN-UHFFFAOYSA-N |
| SMILES | Cc1cccc(NC(=O)Nc2ccccc2)c1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |